About rhodium;nitrate;hexahydrate
rhodium;nitrate;hexahydrate (PubChem CID 173235317) has the molecular formula H12NO9Rh-
and a molecular weight of 273.00 g/mol. Its IUPAC name is rhodium;nitrate;hexahydrate.
Molecular Properties
| Compound Name | rhodium;nitrate;hexahydrate |
| PubChem CID | 173235317 |
| Molecular Formula | H12NO9Rh- |
| Molecular Weight | 273.00 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | rhodium;nitrate;hexahydrate |
| SMILES | O.O.O.O.O.O.O=[N+]([O-])[O-].[Rh] |
| InChI | InChI=1S/NO3.6H2O.Rh/c2-1(3)4;;;;;;;/h;6*1H2;/q-1;;;;;;; |
| InChIKey | WBLJPTRBELHQLV-UHFFFAOYSA-N |
| XLogP | -5.19 |
| TPSA | 255.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.00 |
| LogP ≤ 5 | -5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze rhodium;nitrate;hexahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of rhodium;nitrate;hexahydrate?
The IUPAC name of rhodium;nitrate;hexahydrate (CID 173235317) is rhodium;nitrate;hexahydrate.
What is the SMILES notation for rhodium;nitrate;hexahydrate?
The canonical SMILES for rhodium;nitrate;hexahydrate is O.O.O.O.O.O.O=[N+]([O-])[O-].[Rh].
What is the InChIKey of rhodium;nitrate;hexahydrate?
The InChIKey is WBLJPTRBELHQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.6H2O.Rh/c2-1(3)4;;;;;;;/h;6*1H2;/q-1;;;;;;;.
What are the key properties of rhodium;nitrate;hexahydrate?
rhodium;nitrate;hexahydrate has a molecular weight of 273.00 g/mol, XLogP of -5.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for rhodium;nitrate;hexahydrate is sourced from PubChem (CID 173235317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).