About dinitromethanone;hydroxylamine
dinitromethanone;hydroxylamine (PubChem CID 158323997) has the molecular formula CH3N3O6
and a molecular weight of 153.05 g/mol. Its IUPAC name is dinitromethanone;hydroxylamine.
Molecular Properties
| Compound Name | dinitromethanone;hydroxylamine |
| PubChem CID | 158323997 |
| Molecular Formula | CH3N3O6 |
| Molecular Weight | 153.05 g/mol |
| Exact Mass | 153.00 |
| IUPAC Name | dinitromethanone;hydroxylamine |
| SMILES | NO.O=C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/CN2O5.H3NO/c4-1(2(5)6)3(7)8;1-2/h;2H,1H2 |
| InChIKey | GPELZDAGKXARMF-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.05 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dinitromethanone;hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dinitromethanone;hydroxylamine?
The IUPAC name of dinitromethanone;hydroxylamine (CID 158323997) is dinitromethanone;hydroxylamine.
What is the SMILES notation for dinitromethanone;hydroxylamine?
The canonical SMILES for dinitromethanone;hydroxylamine is NO.O=C([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of dinitromethanone;hydroxylamine?
The InChIKey is GPELZDAGKXARMF-UHFFFAOYSA-N. The full InChI is InChI=1S/CN2O5.H3NO/c4-1(2(5)6)3(7)8;1-2/h;2H,1H2.
What are the key properties of dinitromethanone;hydroxylamine?
dinitromethanone;hydroxylamine has a molecular weight of 153.05 g/mol, XLogP of -1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dinitromethanone;hydroxylamine is sourced from PubChem (CID 158323997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).