About azanium;urea;nitrate
azanium;urea;nitrate (PubChem CID 10130003) has the molecular formula CH8N4O4
and a molecular weight of 140.10 g/mol. Its IUPAC name is azanium;urea;nitrate.
Molecular Properties
| Compound Name | azanium;urea;nitrate |
| PubChem CID | 10130003 |
| Molecular Formula | CH8N4O4 |
| Molecular Weight | 140.10 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | azanium;urea;nitrate |
| SMILES | NC(N)=O.O=[N+]([O-])[O-].[NH4+] |
| InChI | InChI=1S/CH4N2O.NO3.H3N/c2*2-1(3)4;/h(H4,2,3,4);;1H3/q;-1;/p+1 |
| InChIKey | CSGLCWIAEFNDIL-UHFFFAOYSA-O |
| XLogP | -0.84 |
| TPSA | 171.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.10 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanium;urea;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;urea;nitrate?
The IUPAC name of azanium;urea;nitrate (CID 10130003) is azanium;urea;nitrate.
What is the SMILES notation for azanium;urea;nitrate?
The canonical SMILES for azanium;urea;nitrate is NC(N)=O.O=[N+]([O-])[O-].[NH4+].
What is the InChIKey of azanium;urea;nitrate?
The InChIKey is CSGLCWIAEFNDIL-UHFFFAOYSA-O. The full InChI is InChI=1S/CH4N2O.NO3.H3N/c2*2-1(3)4;/h(H4,2,3,4);;1H3/q;-1;/p+1.
What are the key properties of azanium;urea;nitrate?
azanium;urea;nitrate has a molecular weight of 140.10 g/mol, XLogP of -0.84, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;urea;nitrate is sourced from PubChem (CID 10130003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).