About sodium;but-2-enediamide;nitrate
sodium;but-2-enediamide;nitrate (PubChem CID 175419851) has the molecular formula C4H6N3NaO5
and a molecular weight of 199.10 g/mol. Its IUPAC name is sodium;but-2-enediamide;nitrate.
Molecular Properties
| Compound Name | sodium;but-2-enediamide;nitrate |
| PubChem CID | 175419851 |
| Molecular Formula | C4H6N3NaO5 |
| Molecular Weight | 199.10 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | sodium;but-2-enediamide;nitrate |
| SMILES | NC(=O)C=CC(N)=O.O=[N+]([O-])[O-].[Na+] |
| InChI | InChI=1S/C4H6N2O2.NO3.Na/c5-3(7)1-2-4(6)8;2-1(3)4;/h1-2H,(H2,5,7)(H2,6,8);;/q;-1;+1 |
| InChIKey | LPSMTRONQFYCEE-UHFFFAOYSA-N |
| XLogP | -4.72 |
| TPSA | 152.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.10 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;but-2-enediamide;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;but-2-enediamide;nitrate?
The IUPAC name of sodium;but-2-enediamide;nitrate (CID 175419851) is sodium;but-2-enediamide;nitrate.
What is the SMILES notation for sodium;but-2-enediamide;nitrate?
The canonical SMILES for sodium;but-2-enediamide;nitrate is NC(=O)C=CC(N)=O.O=[N+]([O-])[O-].[Na+].
What is the InChIKey of sodium;but-2-enediamide;nitrate?
The InChIKey is LPSMTRONQFYCEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2.NO3.Na/c5-3(7)1-2-4(6)8;2-1(3)4;/h1-2H,(H2,5,7)(H2,6,8);;/q;-1;+1.
What are the key properties of sodium;but-2-enediamide;nitrate?
sodium;but-2-enediamide;nitrate has a molecular weight of 199.10 g/mol, XLogP of -4.72, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;but-2-enediamide;nitrate is sourced from PubChem (CID 175419851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).