About (E)-but-2-enedioate;chromium(3+);nitrate
(E)-but-2-enedioate;chromium(3+);nitrate (PubChem CID 138394845) has the molecular formula C4H2CrNO7
and a molecular weight of 228.06 g/mol. Its IUPAC name is (E)-but-2-enedioate;chromium(3+);nitrate.
Molecular Properties
| Compound Name | (E)-but-2-enedioate;chromium(3+);nitrate |
| PubChem CID | 138394845 |
| Molecular Formula | C4H2CrNO7 |
| Molecular Weight | 228.06 g/mol |
| Exact Mass | 227.92 |
| IUPAC Name | (E)-but-2-enedioate;chromium(3+);nitrate |
| SMILES | O=C([O-])/C=C\C(=O)[O-].O=[N+]([O-])[O-].[Cr+3] |
| InChI | InChI=1S/C4H4O4.Cr.NO3/c5-3(6)1-2-4(7)8;;2-1(3)4/h1-2H,(H,5,6)(H,7,8);;/q;+3;-1/p-2/b2-1-;; |
| InChIKey | IFEAFZNULQCEHN-UAIGNFCESA-L |
| XLogP | -3.20 |
| TPSA | 146.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.06 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioate;chromium(3+);nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioate;chromium(3+);nitrate?
The IUPAC name of (E)-but-2-enedioate;chromium(3+);nitrate (CID 138394845) is (E)-but-2-enedioate;chromium(3+);nitrate.
What is the SMILES notation for (E)-but-2-enedioate;chromium(3+);nitrate?
The canonical SMILES for (E)-but-2-enedioate;chromium(3+);nitrate is O=C([O-])/C=C\C(=O)[O-].O=[N+]([O-])[O-].[Cr+3].
What is the InChIKey of (E)-but-2-enedioate;chromium(3+);nitrate?
The InChIKey is IFEAFZNULQCEHN-UAIGNFCESA-L. The full InChI is InChI=1S/C4H4O4.Cr.NO3/c5-3(6)1-2-4(7)8;;2-1(3)4/h1-2H,(H,5,6)(H,7,8);;/q;+3;-1/p-2/b2-1-;;.
What are the key properties of (E)-but-2-enedioate;chromium(3+);nitrate?
(E)-but-2-enedioate;chromium(3+);nitrate has a molecular weight of 228.06 g/mol, XLogP of -3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioate;chromium(3+);nitrate is sourced from PubChem (CID 138394845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).