About bis(manganese(2+));carbonate;nitrate
bis(manganese(2+));carbonate;nitrate (PubChem CID 162081205) has the molecular formula CMn2NO6+
and a molecular weight of 231.89 g/mol. Its IUPAC name is bis(manganese(2+));carbonate;nitrate.
Molecular Properties
| Compound Name | bis(manganese(2+));carbonate;nitrate |
| PubChem CID | 162081205 |
| Molecular Formula | CMn2NO6+ |
| Molecular Weight | 231.89 g/mol |
| Exact Mass | 231.85 |
| IUPAC Name | bis(manganese(2+));carbonate;nitrate |
| SMILES | O=C([O-])[O-].O=[N+]([O-])[O-].[Mn+2].[Mn+2] |
| InChI | InChI=1S/CH2O3.2Mn.NO3/c2-1(3)4;;;2-1(3)4/h(H2,2,3,4);;;/q;2*+2;-1/p-2 |
| InChIKey | ZCJFVHIEOKWFGB-UHFFFAOYSA-L |
| XLogP | -2.69 |
| TPSA | 129.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.89 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(manganese(2+));carbonate;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(manganese(2+));carbonate;nitrate?
The IUPAC name of bis(manganese(2+));carbonate;nitrate (CID 162081205) is bis(manganese(2+));carbonate;nitrate.
What is the SMILES notation for bis(manganese(2+));carbonate;nitrate?
The canonical SMILES for bis(manganese(2+));carbonate;nitrate is O=C([O-])[O-].O=[N+]([O-])[O-].[Mn+2].[Mn+2].
What is the InChIKey of bis(manganese(2+));carbonate;nitrate?
The InChIKey is ZCJFVHIEOKWFGB-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.2Mn.NO3/c2-1(3)4;;;2-1(3)4/h(H2,2,3,4);;;/q;2*+2;-1/p-2.
What are the key properties of bis(manganese(2+));carbonate;nitrate?
bis(manganese(2+));carbonate;nitrate has a molecular weight of 231.89 g/mol, XLogP of -2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(manganese(2+));carbonate;nitrate is sourced from PubChem (CID 162081205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).