About calcium;acetate;nitrate
calcium;acetate;nitrate (PubChem CID 175242971) has the molecular formula C2H3CaNO5
and a molecular weight of 161.13 g/mol. Its IUPAC name is calcium;acetate;nitrate.
Molecular Properties
| Compound Name | calcium;acetate;nitrate |
| PubChem CID | 175242971 |
| Molecular Formula | C2H3CaNO5 |
| Molecular Weight | 161.13 g/mol |
| Exact Mass | 160.96 |
| IUPAC Name | calcium;acetate;nitrate |
| SMILES | CC(=O)[O-].O=[N+]([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C2H4O2.Ca.NO3/c1-2(3)4;;2-1(3)4/h1H3,(H,3,4);;/q;+2;-1/p-1 |
| InChIKey | SHGMLQLPTZSBBI-UHFFFAOYSA-M |
| XLogP | -1.86 |
| TPSA | 106.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.13 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze calcium;acetate;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;acetate;nitrate?
The IUPAC name of calcium;acetate;nitrate (CID 175242971) is calcium;acetate;nitrate.
What is the SMILES notation for calcium;acetate;nitrate?
The canonical SMILES for calcium;acetate;nitrate is CC(=O)[O-].O=[N+]([O-])[O-].[Ca+2].
What is the InChIKey of calcium;acetate;nitrate?
The InChIKey is SHGMLQLPTZSBBI-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.Ca.NO3/c1-2(3)4;;2-1(3)4/h1H3,(H,3,4);;/q;+2;-1/p-1.
What are the key properties of calcium;acetate;nitrate?
calcium;acetate;nitrate has a molecular weight of 161.13 g/mol, XLogP of -1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;acetate;nitrate is sourced from PubChem (CID 175242971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).