About bis(cerium(3+));acetate;nitrate
bis(cerium(3+));acetate;nitrate (PubChem CID 22023657) has the molecular formula C2H3Ce2NO5+4
and a molecular weight of 401.28 g/mol. Its IUPAC name is bis(cerium(3+));acetate;nitrate.
Molecular Properties
| Compound Name | bis(cerium(3+));acetate;nitrate |
| PubChem CID | 22023657 |
| Molecular Formula | C2H3Ce2NO5+4 |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.81 |
| IUPAC Name | bis(cerium(3+));acetate;nitrate |
| SMILES | CC(=O)[O-].O=[N+]([O-])[O-].[Ce+3].[Ce+3] |
| InChI | InChI=1S/C2H4O2.2Ce.NO3/c1-2(3)4;;;2-1(3)4/h1H3,(H,3,4);;;/q;2*+3;-1/p-1 |
| InChIKey | VRYREORLCFUZBN-UHFFFAOYSA-M |
| XLogP | -1.48 |
| TPSA | 106.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(cerium(3+));acetate;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cerium(3+));acetate;nitrate?
The IUPAC name of bis(cerium(3+));acetate;nitrate (CID 22023657) is bis(cerium(3+));acetate;nitrate.
What is the SMILES notation for bis(cerium(3+));acetate;nitrate?
The canonical SMILES for bis(cerium(3+));acetate;nitrate is CC(=O)[O-].O=[N+]([O-])[O-].[Ce+3].[Ce+3].
What is the InChIKey of bis(cerium(3+));acetate;nitrate?
The InChIKey is VRYREORLCFUZBN-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.2Ce.NO3/c1-2(3)4;;;2-1(3)4/h1H3,(H,3,4);;;/q;2*+3;-1/p-1.
What are the key properties of bis(cerium(3+));acetate;nitrate?
bis(cerium(3+));acetate;nitrate has a molecular weight of 401.28 g/mol, XLogP of -1.48, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cerium(3+));acetate;nitrate is sourced from PubChem (CID 22023657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).