About bis(cadmium(2+));acetate;bromide
bis(cadmium(2+));acetate;bromide (PubChem CID 172734045) has the molecular formula C2H3BrCd2O2+2
and a molecular weight of 363.77 g/mol. Its IUPAC name is bis(cadmium(2+));acetate;bromide.
Molecular Properties
| Compound Name | bis(cadmium(2+));acetate;bromide |
| PubChem CID | 172734045 |
| Molecular Formula | C2H3BrCd2O2+2 |
| Molecular Weight | 363.77 g/mol |
| Exact Mass | 365.74 |
| IUPAC Name | bis(cadmium(2+));acetate;bromide |
| SMILES | CC(=O)[O-].[Br-].[Cd+2].[Cd+2] |
| InChI | InChI=1S/C2H4O2.BrH.2Cd/c1-2(3)4;;;/h1H3,(H,3,4);1H;;/q;;2*+2/p-2 |
| InChIKey | IEMXCRCRFMZIJZ-UHFFFAOYSA-L |
| XLogP | -4.24 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.77 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(cadmium(2+));acetate;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cadmium(2+));acetate;bromide?
The IUPAC name of bis(cadmium(2+));acetate;bromide (CID 172734045) is bis(cadmium(2+));acetate;bromide.
What is the SMILES notation for bis(cadmium(2+));acetate;bromide?
The canonical SMILES for bis(cadmium(2+));acetate;bromide is CC(=O)[O-].[Br-].[Cd+2].[Cd+2].
What is the InChIKey of bis(cadmium(2+));acetate;bromide?
The InChIKey is IEMXCRCRFMZIJZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.BrH.2Cd/c1-2(3)4;;;/h1H3,(H,3,4);1H;;/q;;2*+2/p-2.
What are the key properties of bis(cadmium(2+));acetate;bromide?
bis(cadmium(2+));acetate;bromide has a molecular weight of 363.77 g/mol, XLogP of -4.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cadmium(2+));acetate;bromide is sourced from PubChem (CID 172734045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).