About dicalcium;carbonate;dinitrate
dicalcium;carbonate;dinitrate (PubChem CID 19782802) has the molecular formula CCa2N2O9
and a molecular weight of 264.17 g/mol. Its IUPAC name is dicalcium;carbonate;dinitrate.
Molecular Properties
| Compound Name | dicalcium;carbonate;dinitrate |
| PubChem CID | 19782802 |
| Molecular Formula | CCa2N2O9 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.89 |
| IUPAC Name | dicalcium;carbonate;dinitrate |
| SMILES | O=C([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Ca+2].[Ca+2] |
| InChI | InChI=1S/CH2O3.2Ca.2NO3/c2-1(3)4;;;2*2-1(3)4/h(H2,2,3,4);;;;/q;2*+2;2*-1/p-2 |
| InChIKey | NYEFNVKJJLYDIK-UHFFFAOYSA-L |
| XLogP | -3.69 |
| TPSA | 195.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dicalcium;carbonate;dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicalcium;carbonate;dinitrate?
The IUPAC name of dicalcium;carbonate;dinitrate (CID 19782802) is dicalcium;carbonate;dinitrate.
What is the SMILES notation for dicalcium;carbonate;dinitrate?
The canonical SMILES for dicalcium;carbonate;dinitrate is O=C([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Ca+2].[Ca+2].
What is the InChIKey of dicalcium;carbonate;dinitrate?
The InChIKey is NYEFNVKJJLYDIK-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.2Ca.2NO3/c2-1(3)4;;;2*2-1(3)4/h(H2,2,3,4);;;;/q;2*+2;2*-1/p-2.
What are the key properties of dicalcium;carbonate;dinitrate?
dicalcium;carbonate;dinitrate has a molecular weight of 264.17 g/mol, XLogP of -3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for dicalcium;carbonate;dinitrate is sourced from PubChem (CID 19782802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).