About copper;manganese(2+);carbonate
copper;manganese(2+);carbonate (PubChem CID 174880138) has the molecular formula CCuMnO3
and a molecular weight of 178.49 g/mol. Its IUPAC name is copper;manganese(2+);carbonate.
Molecular Properties
| Compound Name | copper;manganese(2+);carbonate |
| PubChem CID | 174880138 |
| Molecular Formula | CCuMnO3 |
| Molecular Weight | 178.49 g/mol |
| Exact Mass | 177.85 |
| IUPAC Name | copper;manganese(2+);carbonate |
| SMILES | O=C([O-])[O-].[Cu].[Mn+2] |
| InChI | InChI=1S/CH2O3.Cu.Mn/c2-1(3)4;;/h(H2,2,3,4);;/q;;+2/p-2 |
| InChIKey | XFXVBNZYPKIFAD-UHFFFAOYSA-L |
| XLogP | -2.45 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.49 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze copper;manganese(2+);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;manganese(2+);carbonate?
The IUPAC name of copper;manganese(2+);carbonate (CID 174880138) is copper;manganese(2+);carbonate.
What is the SMILES notation for copper;manganese(2+);carbonate?
The canonical SMILES for copper;manganese(2+);carbonate is O=C([O-])[O-].[Cu].[Mn+2].
What is the InChIKey of copper;manganese(2+);carbonate?
The InChIKey is XFXVBNZYPKIFAD-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Cu.Mn/c2-1(3)4;;/h(H2,2,3,4);;/q;;+2/p-2.
What are the key properties of copper;manganese(2+);carbonate?
copper;manganese(2+);carbonate has a molecular weight of 178.49 g/mol, XLogP of -2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;manganese(2+);carbonate is sourced from PubChem (CID 174880138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).