About dilithium;niobium;carbonate
dilithium;niobium;carbonate (PubChem CID 174670751) has the molecular formula CLi2NbO3
and a molecular weight of 166.80 g/mol. Its IUPAC name is dilithium;niobium;carbonate.
Molecular Properties
| Compound Name | dilithium;niobium;carbonate |
| PubChem CID | 174670751 |
| Molecular Formula | CLi2NbO3 |
| Molecular Weight | 166.80 g/mol |
| Exact Mass | 166.92 |
| IUPAC Name | dilithium;niobium;carbonate |
| SMILES | O=C([O-])[O-].[Li+].[Li+].[Nb] |
| InChI | InChI=1S/CH2O3.2Li.Nb/c2-1(3)4;;;/h(H2,2,3,4);;;/q;2*+1;/p-2 |
| InChIKey | PHVDQXZNLNYQNZ-UHFFFAOYSA-L |
| XLogP | -8.44 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.80 |
| LogP ≤ 5 | -8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dilithium;niobium;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;niobium;carbonate?
The IUPAC name of dilithium;niobium;carbonate (CID 174670751) is dilithium;niobium;carbonate.
What is the SMILES notation for dilithium;niobium;carbonate?
The canonical SMILES for dilithium;niobium;carbonate is O=C([O-])[O-].[Li+].[Li+].[Nb].
What is the InChIKey of dilithium;niobium;carbonate?
The InChIKey is PHVDQXZNLNYQNZ-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.2Li.Nb/c2-1(3)4;;;/h(H2,2,3,4);;;/q;2*+1;/p-2.
What are the key properties of dilithium;niobium;carbonate?
dilithium;niobium;carbonate has a molecular weight of 166.80 g/mol, XLogP of -8.44, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;niobium;carbonate is sourced from PubChem (CID 174670751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).