About dilithium;sulfidoformate
dilithium;sulfidoformate (PubChem CID 22336321) has the molecular formula CLi2O2S
and a molecular weight of 89.96 g/mol. Its IUPAC name is dilithium;sulfidoformate.
Molecular Properties
| Compound Name | dilithium;sulfidoformate |
| PubChem CID | 22336321 |
| Molecular Formula | CLi2O2S |
| Molecular Weight | 89.96 g/mol |
| Exact Mass | 89.99 |
| IUPAC Name | dilithium;sulfidoformate |
| SMILES | O=C([O-])[S-].[Li+].[Li+] |
| InChI | InChI=1S/CH2O2S.2Li/c2-1(3)4;;/h4H,(H,2,3);;/q;2*+1/p-2 |
| InChIKey | MIQLYOGQQPOYRG-UHFFFAOYSA-L |
| XLogP | -7.12 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.96 |
| LogP ≤ 5 | -7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dilithium;sulfidoformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;sulfidoformate?
The IUPAC name of dilithium;sulfidoformate (CID 22336321) is dilithium;sulfidoformate.
What is the SMILES notation for dilithium;sulfidoformate?
The canonical SMILES for dilithium;sulfidoformate is O=C([O-])[S-].[Li+].[Li+].
What is the InChIKey of dilithium;sulfidoformate?
The InChIKey is MIQLYOGQQPOYRG-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O2S.2Li/c2-1(3)4;;/h4H,(H,2,3);;/q;2*+1/p-2.
What are the key properties of dilithium;sulfidoformate?
dilithium;sulfidoformate has a molecular weight of 89.96 g/mol, XLogP of -7.12, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;sulfidoformate is sourced from PubChem (CID 22336321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).