About azane;N-nitronitramide
azane;N-nitronitramide (PubChem CID 173137160) has the molecular formula H4N4O4
and a molecular weight of 124.06 g/mol. Its IUPAC name is azane;N-nitronitramide.
Molecular Properties
| Compound Name | azane;N-nitronitramide |
| PubChem CID | 173137160 |
| Molecular Formula | H4N4O4 |
| Molecular Weight | 124.06 g/mol |
| Exact Mass | 124.02 |
| IUPAC Name | azane;N-nitronitramide |
| SMILES | N.O=[N+]([O-])N[N+](=O)[O-] |
| InChI | InChI=1S/HN3O4.H3N/c4-2(5)1-3(6)7;/h1H;1H3 |
| InChIKey | OGTKRUYCBGJWBV-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.06 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;N-nitronitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-nitronitramide?
The IUPAC name of azane;N-nitronitramide (CID 173137160) is azane;N-nitronitramide.
What is the SMILES notation for azane;N-nitronitramide?
The canonical SMILES for azane;N-nitronitramide is N.O=[N+]([O-])N[N+](=O)[O-].
What is the InChIKey of azane;N-nitronitramide?
The InChIKey is OGTKRUYCBGJWBV-UHFFFAOYSA-N. The full InChI is InChI=1S/HN3O4.H3N/c4-2(5)1-3(6)7;/h1H;1H3.
What are the key properties of azane;N-nitronitramide?
azane;N-nitronitramide has a molecular weight of 124.06 g/mol, XLogP of -0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-nitronitramide is sourced from PubChem (CID 173137160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).