About azane;nickel;nitrate
azane;nickel;nitrate (PubChem CID 173089186) has the molecular formula H3N2NiO3-
and a molecular weight of 137.73 g/mol. Its IUPAC name is azane;nickel;nitrate.
Molecular Properties
| Compound Name | azane;nickel;nitrate |
| PubChem CID | 173089186 |
| Molecular Formula | H3N2NiO3- |
| Molecular Weight | 137.73 g/mol |
| Exact Mass | 136.95 |
| IUPAC Name | azane;nickel;nitrate |
| SMILES | N.O=[N+]([O-])[O-].[Ni] |
| InChI | InChI=1S/NO3.H3N.Ni/c2-1(3)4;;/h;1H3;/q-1;; |
| InChIKey | FBAZCZFUGZHBMZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 101.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.73 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;nickel;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;nickel;nitrate?
The IUPAC name of azane;nickel;nitrate (CID 173089186) is azane;nickel;nitrate.
What is the SMILES notation for azane;nickel;nitrate?
The canonical SMILES for azane;nickel;nitrate is N.O=[N+]([O-])[O-].[Ni].
What is the InChIKey of azane;nickel;nitrate?
The InChIKey is FBAZCZFUGZHBMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.H3N.Ni/c2-1(3)4;;/h;1H3;/q-1;;.
What are the key properties of azane;nickel;nitrate?
azane;nickel;nitrate has a molecular weight of 137.73 g/mol, XLogP of -0.08, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;nickel;nitrate is sourced from PubChem (CID 173089186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).