CH7N5O4Zn — CID 175035338
1,3-diaminourea;nitric acid;zinc (PubChem CID 175035338) has the molecular formula CH7N5O4Zn and a molecular weight of 218.49 g/mol. Its IUPAC name is 1,3-diaminourea;nitric acid;zinc.
| Compound Name | 1,3-diaminourea;nitric acid;zinc |
|---|---|
| PubChem CID | 175035338 |
| Molecular Formula | CH7N5O4Zn |
| Molecular Weight | 218.49 g/mol |
| Exact Mass | 216.98 |
| IUPAC Name | 1,3-diaminourea;nitric acid;zinc |
| SMILES | NNC(=O)NN.O=[N+]([O-])O.[Zn] |
| InChI | InChI=1S/CH6N4O.HNO3.Zn/c2-4-1(6)5-3;2-1(3)4;/h2-3H2,(H2,4,5,6);(H,2,3,4); |
| InChIKey | NNPIIZIGFUBRPF-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 156.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.49 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|