C7H12N4O3 — CID 19387491
benzene-1,4-diol;1,3-diaminourea (PubChem CID 19387491) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is benzene-1,4-diol;1,3-diaminourea.
| Compound Name | benzene-1,4-diol;1,3-diaminourea |
|---|---|
| PubChem CID | 19387491 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | benzene-1,4-diol;1,3-diaminourea |
| SMILES | NNC(=O)NN.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.CH6N4O/c7-5-1-2-6(8)4-3-5;2-4-1(6)5-3/h1-4,7-8H;2-3H2,(H2,4,5,6) |
| InChIKey | KYOMEGNBULNCBE-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|