About 1,3-diaminourea;phosphane
1,3-diaminourea;phosphane (PubChem CID 159962214) has the molecular formula CH9N4OP
and a molecular weight of 124.08 g/mol. Its IUPAC name is 1,3-diaminourea;phosphane.
Molecular Properties
| Compound Name | 1,3-diaminourea;phosphane |
| PubChem CID | 159962214 |
| Molecular Formula | CH9N4OP |
| Molecular Weight | 124.08 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 1,3-diaminourea;phosphane |
| SMILES | NNC(=O)NN.P |
| InChI | InChI=1S/CH6N4O.H3P/c2-4-1(6)5-3;/h2-3H2,(H2,4,5,6);1H3 |
| InChIKey | ODMBHUMAFJISSV-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.08 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diaminourea;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diaminourea;phosphane?
The IUPAC name of 1,3-diaminourea;phosphane (CID 159962214) is 1,3-diaminourea;phosphane.
What is the SMILES notation for 1,3-diaminourea;phosphane?
The canonical SMILES for 1,3-diaminourea;phosphane is NNC(=O)NN.P.
What is the InChIKey of 1,3-diaminourea;phosphane?
The InChIKey is ODMBHUMAFJISSV-UHFFFAOYSA-N. The full InChI is InChI=1S/CH6N4O.H3P/c2-4-1(6)5-3;/h2-3H2,(H2,4,5,6);1H3.
What are the key properties of 1,3-diaminourea;phosphane?
1,3-diaminourea;phosphane has a molecular weight of 124.08 g/mol, XLogP of -1.91, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diaminourea;phosphane is sourced from PubChem (CID 159962214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).