C6H21N4O2P — CID 174890706
1,3-diaminourea;pentan-2-ol;phosphane (PubChem CID 174890706) has the molecular formula C6H21N4O2P and a molecular weight of 212.23 g/mol. Its IUPAC name is 1,3-diaminourea;pentan-2-ol;phosphane.
| Compound Name | 1,3-diaminourea;pentan-2-ol;phosphane |
|---|---|
| PubChem CID | 174890706 |
| Molecular Formula | C6H21N4O2P |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1,3-diaminourea;pentan-2-ol;phosphane |
| SMILES | CCCC(C)O.NNC(=O)NN.P |
| InChI | InChI=1S/C5H12O.CH6N4O.H3P/c1-3-4-5(2)6;2-4-1(6)5-3;/h5-6H,3-4H2,1-2H3;2-3H2,(H2,4,5,6);1H3 |
| InChIKey | KZNBRHGOGDNYEG-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|