About magnesium 1,3-diaminourea
magnesium 1,3-diaminourea (PubChem CID 22123853) has the molecular formula CH6MgN4O+2
and a molecular weight of 114.39 g/mol. Its IUPAC name is magnesium 1,3-diaminourea.
Molecular Properties
| Compound Name | magnesium 1,3-diaminourea |
| PubChem CID | 22123853 |
| Molecular Formula | CH6MgN4O+2 |
| Molecular Weight | 114.39 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | magnesium 1,3-diaminourea |
| SMILES | NNC(=O)NN.[Mg+2] |
| InChI | InChI=1S/CH6N4O.Mg/c2-4-1(6)5-3;/h2-3H2,(H2,4,5,6);/q;+2 |
| InChIKey | PZMGIZCAWTZIRO-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.39 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze magnesium 1,3-diaminourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium 1,3-diaminourea?
The IUPAC name of magnesium 1,3-diaminourea (CID 22123853) is magnesium 1,3-diaminourea.
What is the SMILES notation for magnesium 1,3-diaminourea?
The canonical SMILES for magnesium 1,3-diaminourea is NNC(=O)NN.[Mg+2].
What is the InChIKey of magnesium 1,3-diaminourea?
The InChIKey is PZMGIZCAWTZIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/CH6N4O.Mg/c2-4-1(6)5-3;/h2-3H2,(H2,4,5,6);/q;+2.
What are the key properties of magnesium 1,3-diaminourea?
magnesium 1,3-diaminourea has a molecular weight of 114.39 g/mol, XLogP of -2.35, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium 1,3-diaminourea is sourced from PubChem (CID 22123853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).