C3H8N4O5 — CID 174832564
1,3-diaminourea;oxalic acid (PubChem CID 174832564) has the molecular formula C3H8N4O5 and a molecular weight of 180.12 g/mol. Its IUPAC name is 1,3-diaminourea;oxalic acid.
| Compound Name | 1,3-diaminourea;oxalic acid |
|---|---|
| PubChem CID | 174832564 |
| Molecular Formula | C3H8N4O5 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 1,3-diaminourea;oxalic acid |
| SMILES | NNC(=O)NN.O=C(O)C(=O)O |
| InChI | InChI=1S/C2H2O4.CH6N4O/c3-1(4)2(5)6;2-4-1(6)5-3/h(H,3,4)(H,5,6);2-3H2,(H2,4,5,6) |
| InChIKey | LIYMYTKHWVXOGH-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|