azonous acid;oxalic acid

C2H8N2O8 — CID 172853000

IUPACazonous acid;oxalic acid
SMILESO=C(O)C(=O)O.ONO.ONO
InChIInChI=1S/C2H2O4.2H3NO2/c3-1(4)2(5)6;2*2-1-3/h(H,3,4)(H,5,6);2*1-3H
InChIKeyYHXMJGXJARIJHK-UHFFFAOYSA-N
MW188.09 g/mol
LogP-2.14
Rot. Bonds

About azonous acid;oxalic acid

azonous acid;oxalic acid (PubChem CID 172853000) has the molecular formula C2H8N2O8 and a molecular weight of 188.09 g/mol. Its IUPAC name is azonous acid;oxalic acid.

Molecular Properties

Compound Nameazonous acid;oxalic acid
PubChem CID172853000
Molecular FormulaC2H8N2O8
Molecular Weight188.09 g/mol
Exact Mass188.03
IUPAC Nameazonous acid;oxalic acid
SMILESO=C(O)C(=O)O.ONO.ONO
InChIInChI=1S/C2H2O4.2H3NO2/c3-1(4)2(5)6;2*2-1-3/h(H,3,4)(H,5,6);2*1-3H
InChIKeyYHXMJGXJARIJHK-UHFFFAOYSA-N
XLogP-2.14
TPSA179.58 Ų
H-Bond Donors8
H-Bond Acceptors8
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500188.09
LogP ≤ 5-2.14
H-Bond Donors ≤ 58
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze azonous acid;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azonous acid;oxalic acid?
The IUPAC name of azonous acid;oxalic acid (CID 172853000) is azonous acid;oxalic acid.
What is the SMILES notation for azonous acid;oxalic acid?
The canonical SMILES for azonous acid;oxalic acid is O=C(O)C(=O)O.ONO.ONO.
What is the InChIKey of azonous acid;oxalic acid?
The InChIKey is YHXMJGXJARIJHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.2H3NO2/c3-1(4)2(5)6;2*2-1-3/h(H,3,4)(H,5,6);2*1-3H.
What are the key properties of azonous acid;oxalic acid?
azonous acid;oxalic acid has a molecular weight of 188.09 g/mol, XLogP of -2.14, 0 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for azonous acid;oxalic acid is sourced from PubChem (CID 172853000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).