About californium;oxalic acid
californium;oxalic acid (PubChem CID 87427078) has the molecular formula C2H2CfO4
and a molecular weight of 341.03 g/mol. Its IUPAC name is californium;oxalic acid.
Molecular Properties
| Compound Name | californium;oxalic acid |
| PubChem CID | 87427078 |
| Molecular Formula | C2H2CfO4 |
| Molecular Weight | 341.03 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | californium;oxalic acid |
| SMILES | O=C(O)C(=O)O.[Cf] |
| InChI | InChI=1S/C2H2O4.Cf/c3-1(4)2(5)6;/h(H,3,4)(H,5,6); |
| InChIKey | UCELIJYCEMIFGE-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.03 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze californium;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of californium;oxalic acid?
The IUPAC name of californium;oxalic acid (CID 87427078) is californium;oxalic acid.
What is the SMILES notation for californium;oxalic acid?
The canonical SMILES for californium;oxalic acid is O=C(O)C(=O)O.[Cf].
What is the InChIKey of californium;oxalic acid?
The InChIKey is UCELIJYCEMIFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.Cf/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);.
What are the key properties of californium;oxalic acid?
californium;oxalic acid has a molecular weight of 341.03 g/mol, XLogP of -0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for californium;oxalic acid is sourced from PubChem (CID 87427078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).