About oxalic acid;thorium
oxalic acid;thorium (PubChem CID 25199595) has the molecular formula C4H4O8Th
and a molecular weight of 412.11 g/mol. Its IUPAC name is oxalic acid;thorium.
Molecular Properties
| Compound Name | oxalic acid;thorium |
| PubChem CID | 25199595 |
| Molecular Formula | C4H4O8Th |
| Molecular Weight | 412.11 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | oxalic acid;thorium |
| SMILES | O=C(O)C(=O)O.O=C(O)C(=O)O.[Th] |
| InChI | InChI=1S/2C2H2O4.Th/c2*3-1(4)2(5)6;/h2*(H,3,4)(H,5,6); |
| InChIKey | MVVXFNGAKVVFBW-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.11 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;thorium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;thorium?
The IUPAC name of oxalic acid;thorium (CID 25199595) is oxalic acid;thorium.
What is the SMILES notation for oxalic acid;thorium?
The canonical SMILES for oxalic acid;thorium is O=C(O)C(=O)O.O=C(O)C(=O)O.[Th].
What is the InChIKey of oxalic acid;thorium?
The InChIKey is MVVXFNGAKVVFBW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H2O4.Th/c2*3-1(4)2(5)6;/h2*(H,3,4)(H,5,6);.
What are the key properties of oxalic acid;thorium?
oxalic acid;thorium has a molecular weight of 412.11 g/mol, XLogP of -1.69, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;thorium is sourced from PubChem (CID 25199595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).