About oxalic acid;tantalum;hydrate
oxalic acid;tantalum;hydrate (PubChem CID 174144106) has the molecular formula C2H4O5Ta
and a molecular weight of 289.00 g/mol. Its IUPAC name is oxalic acid;tantalum;hydrate.
Molecular Properties
| Compound Name | oxalic acid;tantalum;hydrate |
| PubChem CID | 174144106 |
| Molecular Formula | C2H4O5Ta |
| Molecular Weight | 289.00 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | oxalic acid;tantalum;hydrate |
| SMILES | O.O=C(O)C(=O)O.[Ta] |
| InChI | InChI=1S/C2H2O4.H2O.Ta/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);1H2; |
| InChIKey | XKWKEMZTYZYONN-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.00 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;tantalum;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;tantalum;hydrate?
The IUPAC name of oxalic acid;tantalum;hydrate (CID 174144106) is oxalic acid;tantalum;hydrate.
What is the SMILES notation for oxalic acid;tantalum;hydrate?
The canonical SMILES for oxalic acid;tantalum;hydrate is O.O=C(O)C(=O)O.[Ta].
What is the InChIKey of oxalic acid;tantalum;hydrate?
The InChIKey is XKWKEMZTYZYONN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.H2O.Ta/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);1H2;.
What are the key properties of oxalic acid;tantalum;hydrate?
oxalic acid;tantalum;hydrate has a molecular weight of 289.00 g/mol, XLogP of -1.67, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;tantalum;hydrate is sourced from PubChem (CID 174144106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).