About CID 172800195
CID 172800195 (PubChem CID 172800195) has the molecular formula CH6N4NaO
and a molecular weight of 113.08 g/mol.
Molecular Properties
| Compound Name | CID 172800195 |
| PubChem CID | 172800195 |
| Molecular Formula | CH6N4NaO |
| Molecular Weight | 113.08 g/mol |
| Exact Mass | 113.04 |
| IUPAC Name | — |
| SMILES | NNC(=O)NN.[Na] |
| InChI | InChI=1S/CH6N4O.Na/c2-4-1(6)5-3;/h2-3H2,(H2,4,5,6); |
| InChIKey | QTHQKPHKNWTZIP-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.08 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 172800195 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172800195?
The IUPAC name of CID 172800195 (CID 172800195) is not available.
What is the SMILES notation for CID 172800195?
The canonical SMILES for CID 172800195 is NNC(=O)NN.[Na].
What is the InChIKey of CID 172800195?
The InChIKey is QTHQKPHKNWTZIP-UHFFFAOYSA-N. The full InChI is InChI=1S/CH6N4O.Na/c2-4-1(6)5-3;/h2-3H2,(H2,4,5,6);.
What are the key properties of CID 172800195?
CID 172800195 has a molecular weight of 113.08 g/mol, XLogP of -2.35, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172800195 is sourced from PubChem (CID 172800195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).