C4H6N2O6S — CID 88732925
2,2-dinitropropoxymethanethioic S-acid (PubChem CID 88732925) has the molecular formula C4H6N2O6S and a molecular weight of 210.17 g/mol. Its IUPAC name is 2,2-dinitropropoxymethanethioic S-acid.
| Compound Name | 2,2-dinitropropoxymethanethioic S-acid |
|---|---|
| PubChem CID | 88732925 |
| Molecular Formula | C4H6N2O6S |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 2,2-dinitropropoxymethanethioic S-acid |
| SMILES | CC(COC(=O)S)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H6N2O6S/c1-4(5(8)9,6(10)11)2-12-3(7)13/h2H2,1H3,(H,7,13) |
| InChIKey | VOLBVSDNFUDBRW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|