C3H5ClN2O7S — CID 55280035
1-chlorosulfonyloxy-2,2-dinitropropane (PubChem CID 55280035) has the molecular formula C3H5ClN2O7S and a molecular weight of 248.60 g/mol. Its IUPAC name is 1-chlorosulfonyloxy-2,2-dinitropropane.
| Compound Name | 1-chlorosulfonyloxy-2,2-dinitropropane |
|---|---|
| PubChem CID | 55280035 |
| Molecular Formula | C3H5ClN2O7S |
| Molecular Weight | 248.60 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | 1-chlorosulfonyloxy-2,2-dinitropropane |
| SMILES | CC(COS(=O)(=O)Cl)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C3H5ClN2O7S/c1-3(5(7)8,6(9)10)2-13-14(4,11)12/h2H2,1H3 |
| InChIKey | VUPBRVRTVCWTPQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.60 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|