C13H20N8O20 — CID 19069850
2,2-dinitro-1-[tris(2,2-dinitropropoxy)methoxy]propane (PubChem CID 19069850) has the molecular formula C13H20N8O20 and a molecular weight of 608.34 g/mol. Its IUPAC name is 2,2-dinitro-1-[tris(2,2-dinitropropoxy)methoxy]propane.
| Compound Name | 2,2-dinitro-1-[tris(2,2-dinitropropoxy)methoxy]propane |
|---|---|
| PubChem CID | 19069850 |
| Molecular Formula | C13H20N8O20 |
| Molecular Weight | 608.34 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | 2,2-dinitro-1-[tris(2,2-dinitropropoxy)methoxy]propane |
| SMILES | CC(COC(OCC(C)([N+](=O)[O-])[N+](=O)[O-])(OCC(C)([N+](=O)[O-])[N+](=O)[O-])OCC(C)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N8O20/c1-9(14(22)23,15(24)25)5-38-13(39-6-10(2,16(26)27)17(28)29,40-7-11(3,18(30)31)19(32)33)41-8-12(4,20(34)35)21(36)37/h5-8H2,1-4H3 |
| InChIKey | AEQQIZJWLJPTDY-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 382.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.34 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|