About (2-methyl-2-nitropropyl) sulfite
(2-methyl-2-nitropropyl) sulfite (PubChem CID 174843146) has the molecular formula C4H8NO5S-
and a molecular weight of 182.18 g/mol. Its IUPAC name is (2-methyl-2-nitropropyl) sulfite.
Molecular Properties
| Compound Name | (2-methyl-2-nitropropyl) sulfite |
| PubChem CID | 174843146 |
| Molecular Formula | C4H8NO5S- |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | (2-methyl-2-nitropropyl) sulfite |
| SMILES | CC(C)(COS(=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H9NO5S/c1-4(2,5(6)7)3-10-11(8)9/h3H2,1-2H3,(H,8,9)/p-1 |
| InChIKey | CYAYICFMJVKCEL-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-2-nitropropyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-nitropropyl) sulfite?
The IUPAC name of (2-methyl-2-nitropropyl) sulfite (CID 174843146) is (2-methyl-2-nitropropyl) sulfite.
What is the SMILES notation for (2-methyl-2-nitropropyl) sulfite?
The canonical SMILES for (2-methyl-2-nitropropyl) sulfite is CC(C)(COS(=O)[O-])[N+](=O)[O-].
What is the InChIKey of (2-methyl-2-nitropropyl) sulfite?
The InChIKey is CYAYICFMJVKCEL-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9NO5S/c1-4(2,5(6)7)3-10-11(8)9/h3H2,1-2H3,(H,8,9)/p-1.
What are the key properties of (2-methyl-2-nitropropyl) sulfite?
(2-methyl-2-nitropropyl) sulfite has a molecular weight of 182.18 g/mol, XLogP of -0.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-nitropropyl) sulfite is sourced from PubChem (CID 174843146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).