C10H17Cl2N2O8P — CID 134109582
2,2-dichloroethenyl bis(2-methyl-2-nitropropyl) phosphate (PubChem CID 134109582) has the molecular formula C10H17Cl2N2O8P and a molecular weight of 395.13 g/mol. Its IUPAC name is 2,2-dichloroethenyl bis(2-methyl-2-nitropropyl) phosphate.
| Compound Name | 2,2-dichloroethenyl bis(2-methyl-2-nitropropyl) phosphate |
|---|---|
| PubChem CID | 134109582 |
| Molecular Formula | C10H17Cl2N2O8P |
| Molecular Weight | 395.13 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2,2-dichloroethenyl bis(2-methyl-2-nitropropyl) phosphate |
| SMILES | CC(C)(COP(=O)(OC=C(Cl)Cl)OCC(C)(C)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C10H17Cl2N2O8P/c1-9(2,13(15)16)6-21-23(19,20-5-8(11)12)22-7-10(3,4)14(17)18/h5H,6-7H2,1-4H3 |
| InChIKey | XVQJSWCFGDHUCB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.13 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|