C7H14N2O5 — CID 92840251
(2S)-1-methoxy-2,3-dimethyl-2,3-dinitrobutane (PubChem CID 92840251) has the molecular formula C7H14N2O5 and a molecular weight of 206.20 g/mol. Its IUPAC name is (2S)-1-methoxy-2,3-dimethyl-2,3-dinitrobutane.
| Compound Name | (2S)-1-methoxy-2,3-dimethyl-2,3-dinitrobutane |
|---|---|
| PubChem CID | 92840251 |
| Molecular Formula | C7H14N2O5 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2S)-1-methoxy-2,3-dimethyl-2,3-dinitrobutane |
| SMILES | COC[C@@](C)([N+](=O)[O-])C(C)(C)[N+](=O)[O-] |
| InChI | InChI=1S/C7H14N2O5/c1-6(2,8(10)11)7(3,5-14-4)9(12)13/h5H2,1-4H3/t7-/m1/s1 |
| InChIKey | LFXNWDGMWNVBHF-SSDOTTSWSA-N |
| XLogP | 0.72 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|