C12H20N2O8 — CID 12714361
dimethyl 4,5-dimethyl-4,5-dinitrooctanedioate (PubChem CID 12714361) has the molecular formula C12H20N2O8 and a molecular weight of 320.30 g/mol. Its IUPAC name is dimethyl 4,5-dimethyl-4,5-dinitrooctanedioate.
| Compound Name | dimethyl 4,5-dimethyl-4,5-dinitrooctanedioate |
|---|---|
| PubChem CID | 12714361 |
| Molecular Formula | C12H20N2O8 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | dimethyl 4,5-dimethyl-4,5-dinitrooctanedioate |
| SMILES | COC(=O)CCC(C)([N+](=O)[O-])C(C)(CCC(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C12H20N2O8/c1-11(13(17)18,7-5-9(15)21-3)12(2,14(19)20)8-6-10(16)22-4/h5-8H2,1-4H3 |
| InChIKey | UOOFGNSDDDOUMM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|