About N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide
N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide (PubChem CID 134997260) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide.
Molecular Properties
| Compound Name | N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide |
| PubChem CID | 134997260 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide |
| SMILES | COC(=O)C/[N+]([O-])=C/C(C)(C)C |
| InChI | InChI=1S/C8H15NO3/c1-8(2,3)6-9(11)5-7(10)12-4/h6H,5H2,1-4H3/b9-6- |
| InChIKey | GUTKKSYIDCYQRN-TWGQIWQCSA-N |
| XLogP | 0.79 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide?
The IUPAC name of N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide (CID 134997260) is N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide.
What is the SMILES notation for N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide?
The canonical SMILES for N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide is COC(=O)C/[N+]([O-])=C/C(C)(C)C.
What is the InChIKey of N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide?
The InChIKey is GUTKKSYIDCYQRN-TWGQIWQCSA-N. The full InChI is InChI=1S/C8H15NO3/c1-8(2,3)6-9(11)5-7(10)12-4/h6H,5H2,1-4H3/b9-6-.
What are the key properties of N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide?
N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide has a molecular weight of 173.21 g/mol, XLogP of 0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide is sourced from PubChem (CID 134997260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).