C8H15NO3 — CID 134997260
N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide (PubChem CID 134997260) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide.
| Compound Name | N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide |
|---|---|
| PubChem CID | 134997260 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N-(2-methoxy-2-oxoethyl)-2,2-dimethylpropan-1-imine oxide |
| SMILES | COC(=O)C/[N+]([O-])=C/C(C)(C)C |
| InChI | InChI=1S/C8H15NO3/c1-8(2,3)6-9(11)5-7(10)12-4/h6H,5H2,1-4H3/b9-6- |
| InChIKey | GUTKKSYIDCYQRN-TWGQIWQCSA-N |
| XLogP | 0.79 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|