C12H20O7 — CID 150228781
1-O,2-O-dimethyl 3-O-propyl 2-methoxypropane-1,2,3-tricarboxylate (PubChem CID 150228781) has the molecular formula C12H20O7 and a molecular weight of 276.28 g/mol. Its IUPAC name is 1-O,2-O-dimethyl 3-O-propyl 2-methoxypropane-1,2,3-tricarboxylate.
| Compound Name | 1-O,2-O-dimethyl 3-O-propyl 2-methoxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 150228781 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-O,2-O-dimethyl 3-O-propyl 2-methoxypropane-1,2,3-tricarboxylate |
| SMILES | CCCOC(=O)CC(CC(=O)OC)(OC)C(=O)OC |
| InChI | InChI=1S/C12H20O7/c1-5-6-19-10(14)8-12(18-4,11(15)17-3)7-9(13)16-2/h5-8H2,1-4H3 |
| InChIKey | FVAGXSFDRNEYDL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|