C11H19O8P — CID 88549838
trimethyl 2-dimethylphosphoryloxypropane-1,2,3-tricarboxylate (PubChem CID 88549838) has the molecular formula C11H19O8P and a molecular weight of 310.24 g/mol. Its IUPAC name is trimethyl 2-dimethylphosphoryloxypropane-1,2,3-tricarboxylate.
| Compound Name | trimethyl 2-dimethylphosphoryloxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 88549838 |
| Molecular Formula | C11H19O8P |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | trimethyl 2-dimethylphosphoryloxypropane-1,2,3-tricarboxylate |
| SMILES | COC(=O)CC(CC(=O)OC)(OP(C)(C)=O)C(=O)OC |
| InChI | InChI=1S/C11H19O8P/c1-16-8(12)6-11(10(14)18-3,7-9(13)17-2)19-20(4,5)15/h6-7H2,1-5H3 |
| InChIKey | CLUNHXTTYXZRDM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|