C10H18Cl2O10P2 — CID 54573986
2-chloroethoxy-[2-[2-chloroethoxy(hydroxy)phosphoryl]-1,4-dimethoxy-1,4-dioxobutan-2-yl]phosphinic acid (PubChem CID 54573986) has the molecular formula C10H18Cl2O10P2 and a molecular weight of 431.10 g/mol. Its IUPAC name is 2-chloroethoxy-[2-[2-chloroethoxy(hydroxy)phosphoryl]-1,4-dimethoxy-1,4-dioxobutan-2-yl]phosphinic acid.
| Compound Name | 2-chloroethoxy-[2-[2-chloroethoxy(hydroxy)phosphoryl]-1,4-dimethoxy-1,4-dioxobutan-2-yl]phosphinic acid |
|---|---|
| PubChem CID | 54573986 |
| Molecular Formula | C10H18Cl2O10P2 |
| Molecular Weight | 431.10 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 2-chloroethoxy-[2-[2-chloroethoxy(hydroxy)phosphoryl]-1,4-dimethoxy-1,4-dioxobutan-2-yl]phosphinic acid |
| SMILES | COC(=O)CC(C(=O)OC)(P(=O)(O)OCCCl)P(=O)(O)OCCCl |
| InChI | InChI=1S/C10H18Cl2O10P2/c1-19-8(13)7-10(9(14)20-2,23(15,16)21-5-3-11)24(17,18)22-6-4-12/h3-7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | ZZGUZXDZFINMDW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.10 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|