C12H21O9P — CID 11002299
trimethyl 2-dimethoxyphosphorylbutane-1,2,4-tricarboxylate (PubChem CID 11002299) has the molecular formula C12H21O9P and a molecular weight of 340.27 g/mol. Its IUPAC name is trimethyl 2-dimethoxyphosphorylbutane-1,2,4-tricarboxylate.
| Compound Name | trimethyl 2-dimethoxyphosphorylbutane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 11002299 |
| Molecular Formula | C12H21O9P |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | trimethyl 2-dimethoxyphosphorylbutane-1,2,4-tricarboxylate |
| SMILES | COC(=O)CCC(CC(=O)OC)(C(=O)OC)P(=O)(OC)OC |
| InChI | InChI=1S/C12H21O9P/c1-17-9(13)6-7-12(11(15)19-3,8-10(14)18-2)22(16,20-4)21-5/h6-8H2,1-5H3 |
| InChIKey | DGXIXSPRJLJXSW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|