C11H15NO6 — CID 125499499
trimethyl (2R)-2-cyanobutane-1,2,4-tricarboxylate (PubChem CID 125499499) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is trimethyl (2R)-2-cyanobutane-1,2,4-tricarboxylate.
| Compound Name | trimethyl (2R)-2-cyanobutane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 125499499 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | trimethyl (2R)-2-cyanobutane-1,2,4-tricarboxylate |
| SMILES | COC(=O)CC[C@](C#N)(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H15NO6/c1-16-8(13)4-5-11(7-12,10(15)18-3)6-9(14)17-2/h4-6H2,1-3H3/t11-/m1/s1 |
| InChIKey | JGCDVJGABKCEOZ-LLVKDONJSA-N |
| XLogP | 0.19 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|