C17H22FNO4 — CID 143594790
dimethyl 4-cyano-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]heptanedioate (PubChem CID 143594790) has the molecular formula C17H22FNO4 and a molecular weight of 323.36 g/mol. Its IUPAC name is dimethyl 4-cyano-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]heptanedioate.
| Compound Name | dimethyl 4-cyano-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]heptanedioate |
|---|---|
| PubChem CID | 143594790 |
| Molecular Formula | C17H22FNO4 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | dimethyl 4-cyano-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]heptanedioate |
| SMILES | C=C/C=C(C(\F)=C/C)/C(C#N)(CCC(=O)OC)CCC(=O)OC |
| InChI | InChI=1S/C17H22FNO4/c1-5-7-13(14(18)6-2)17(12-19,10-8-15(20)22-3)11-9-16(21)23-4/h5-7H,1,8-11H2,2-4H3/b13-7+,14-6+ |
| InChIKey | CWKMMEKCLWFLHO-CAZMDNNUSA-N |
| XLogP | 3.39 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|