About hex-5-enenitrile;methyl hex-5-enoate
hex-5-enenitrile;methyl hex-5-enoate (PubChem CID 88843727) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is hex-5-enenitrile;methyl hex-5-enoate.
Molecular Properties
| Compound Name | hex-5-enenitrile;methyl hex-5-enoate |
| PubChem CID | 88843727 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | hex-5-enenitrile;methyl hex-5-enoate |
| SMILES | C=CCCCC#N.C=CCCCC(=O)OC |
| InChI | InChI=1S/C7H12O2.C6H9N/c1-3-4-5-6-7(8)9-2;1-2-3-4-5-6-7/h3H,1,4-6H2,2H3;2H,1,3-5H2 |
| InChIKey | GYPIQJSJRYSSPU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-5-enenitrile;methyl hex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-enenitrile;methyl hex-5-enoate?
The IUPAC name of hex-5-enenitrile;methyl hex-5-enoate (CID 88843727) is hex-5-enenitrile;methyl hex-5-enoate.
What is the SMILES notation for hex-5-enenitrile;methyl hex-5-enoate?
The canonical SMILES for hex-5-enenitrile;methyl hex-5-enoate is C=CCCCC#N.C=CCCCC(=O)OC.
What is the InChIKey of hex-5-enenitrile;methyl hex-5-enoate?
The InChIKey is GYPIQJSJRYSSPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C6H9N/c1-3-4-5-6-7(8)9-2;1-2-3-4-5-6-7/h3H,1,4-6H2,2H3;2H,1,3-5H2.
What are the key properties of hex-5-enenitrile;methyl hex-5-enoate?
hex-5-enenitrile;methyl hex-5-enoate has a molecular weight of 223.32 g/mol, XLogP of 3.38, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-enenitrile;methyl hex-5-enoate is sourced from PubChem (CID 88843727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).