About acetic acid;acetyl hex-5-enoate
acetic acid;acetyl hex-5-enoate (PubChem CID 174849963) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is acetic acid;acetyl hex-5-enoate.
Molecular Properties
| Compound Name | acetic acid;acetyl hex-5-enoate |
| PubChem CID | 174849963 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | acetic acid;acetyl hex-5-enoate |
| SMILES | C=CCCCC(=O)OC(C)=O.CC(=O)O |
| InChI | InChI=1S/C8H12O3.C2H4O2/c1-3-4-5-6-8(10)11-7(2)9;1-2(3)4/h3H,1,4-6H2,2H3;1H3,(H,3,4) |
| InChIKey | RQHSILXFZIQKNC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;acetyl hex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;acetyl hex-5-enoate?
The IUPAC name of acetic acid;acetyl hex-5-enoate (CID 174849963) is acetic acid;acetyl hex-5-enoate.
What is the SMILES notation for acetic acid;acetyl hex-5-enoate?
The canonical SMILES for acetic acid;acetyl hex-5-enoate is C=CCCCC(=O)OC(C)=O.CC(=O)O.
What is the InChIKey of acetic acid;acetyl hex-5-enoate?
The InChIKey is RQHSILXFZIQKNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3.C2H4O2/c1-3-4-5-6-8(10)11-7(2)9;1-2(3)4/h3H,1,4-6H2,2H3;1H3,(H,3,4).
What are the key properties of acetic acid;acetyl hex-5-enoate?
acetic acid;acetyl hex-5-enoate has a molecular weight of 216.23 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;acetyl hex-5-enoate is sourced from PubChem (CID 174849963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).