About 1-hydroxyhex-1-enyl undec-10-enoate
1-hydroxyhex-1-enyl undec-10-enoate (PubChem CID 173165228) has the molecular formula C17H30O3
and a molecular weight of 282.42 g/mol. Its IUPAC name is 1-hydroxyhex-1-enyl undec-10-enoate.
Molecular Properties
| Compound Name | 1-hydroxyhex-1-enyl undec-10-enoate |
| PubChem CID | 173165228 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 1-hydroxyhex-1-enyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OC(O)=CCCCC |
| InChI | InChI=1S/C17H30O3/c1-3-5-7-8-9-10-11-13-15-17(19)20-16(18)14-12-6-4-2/h3,14,18H,1,4-13,15H2,2H3 |
| InChIKey | JJBIRTFKJRZJFU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyhex-1-enyl undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyhex-1-enyl undec-10-enoate?
The IUPAC name of 1-hydroxyhex-1-enyl undec-10-enoate (CID 173165228) is 1-hydroxyhex-1-enyl undec-10-enoate.
What is the SMILES notation for 1-hydroxyhex-1-enyl undec-10-enoate?
The canonical SMILES for 1-hydroxyhex-1-enyl undec-10-enoate is C=CCCCCCCCCC(=O)OC(O)=CCCCC.
What is the InChIKey of 1-hydroxyhex-1-enyl undec-10-enoate?
The InChIKey is JJBIRTFKJRZJFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O3/c1-3-5-7-8-9-10-11-13-15-17(19)20-16(18)14-12-6-4-2/h3,14,18H,1,4-13,15H2,2H3.
What are the key properties of 1-hydroxyhex-1-enyl undec-10-enoate?
1-hydroxyhex-1-enyl undec-10-enoate has a molecular weight of 282.42 g/mol, XLogP of 5.43, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyhex-1-enyl undec-10-enoate is sourced from PubChem (CID 173165228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).