About pentadec-14-en-7-one
pentadec-14-en-7-one (PubChem CID 11528685) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is pentadec-14-en-7-one.
Molecular Properties
| Compound Name | pentadec-14-en-7-one |
| PubChem CID | 11528685 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | pentadec-14-en-7-one |
| SMILES | C=CCCCCCCC(=O)CCCCCC |
| InChI | InChI=1S/C15H28O/c1-3-5-7-9-10-12-14-15(16)13-11-8-6-4-2/h3H,1,4-14H2,2H3 |
| InChIKey | QIVRQFJRUABARQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pentadec-14-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadec-14-en-7-one?
The IUPAC name of pentadec-14-en-7-one (CID 11528685) is pentadec-14-en-7-one.
What is the SMILES notation for pentadec-14-en-7-one?
The canonical SMILES for pentadec-14-en-7-one is C=CCCCCCCC(=O)CCCCCC.
What is the InChIKey of pentadec-14-en-7-one?
The InChIKey is QIVRQFJRUABARQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O/c1-3-5-7-9-10-12-14-15(16)13-11-8-6-4-2/h3H,1,4-14H2,2H3.
What are the key properties of pentadec-14-en-7-one?
pentadec-14-en-7-one has a molecular weight of 224.39 g/mol, XLogP of 5.05, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentadec-14-en-7-one is sourced from PubChem (CID 11528685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).