About tetradec-1-en-5-one
tetradec-1-en-5-one (PubChem CID 11195184) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is tetradec-1-en-5-one.
Molecular Properties
| Compound Name | tetradec-1-en-5-one |
| PubChem CID | 11195184 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | tetradec-1-en-5-one |
| SMILES | C=CCCC(=O)CCCCCCCCC |
| InChI | InChI=1S/C14H26O/c1-3-5-7-8-9-10-11-13-14(15)12-6-4-2/h4H,2-3,5-13H2,1H3 |
| InChIKey | ODLIIOIKNZNRLR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tetradec-1-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradec-1-en-5-one?
The IUPAC name of tetradec-1-en-5-one (CID 11195184) is tetradec-1-en-5-one.
What is the SMILES notation for tetradec-1-en-5-one?
The canonical SMILES for tetradec-1-en-5-one is C=CCCC(=O)CCCCCCCCC.
What is the InChIKey of tetradec-1-en-5-one?
The InChIKey is ODLIIOIKNZNRLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O/c1-3-5-7-8-9-10-11-13-14(15)12-6-4-2/h4H,2-3,5-13H2,1H3.
What are the key properties of tetradec-1-en-5-one?
tetradec-1-en-5-one has a molecular weight of 210.36 g/mol, XLogP of 4.66, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetradec-1-en-5-one is sourced from PubChem (CID 11195184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).