About acetyl 9-oxononanoate
acetyl 9-oxononanoate (PubChem CID 174949350) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is acetyl 9-oxononanoate.
Molecular Properties
| Compound Name | acetyl 9-oxononanoate |
| PubChem CID | 174949350 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | acetyl 9-oxononanoate |
| SMILES | CC(=O)OC(=O)CCCCCCCC=O |
| InChI | InChI=1S/C11H18O4/c1-10(13)15-11(14)8-6-4-2-3-5-7-9-12/h9H,2-8H2,1H3 |
| InChIKey | CIUBQENNDKBKDX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl 9-oxononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 9-oxononanoate?
The IUPAC name of acetyl 9-oxononanoate (CID 174949350) is acetyl 9-oxononanoate.
What is the SMILES notation for acetyl 9-oxononanoate?
The canonical SMILES for acetyl 9-oxononanoate is CC(=O)OC(=O)CCCCCCCC=O.
What is the InChIKey of acetyl 9-oxononanoate?
The InChIKey is CIUBQENNDKBKDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-10(13)15-11(14)8-6-4-2-3-5-7-9-12/h9H,2-8H2,1H3.
What are the key properties of acetyl 9-oxononanoate?
acetyl 9-oxononanoate has a molecular weight of 214.26 g/mol, XLogP of 2.01, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 9-oxononanoate is sourced from PubChem (CID 174949350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).