About amino 12-oxododecanoate
amino 12-oxododecanoate (PubChem CID 57157171) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is amino 12-oxododecanoate.
Molecular Properties
| Compound Name | amino 12-oxododecanoate |
| PubChem CID | 57157171 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | amino 12-oxododecanoate |
| SMILES | NOC(=O)CCCCCCCCCCC=O |
| InChI | InChI=1S/C12H23NO3/c13-16-12(15)10-8-6-4-2-1-3-5-7-9-11-14/h11H,1-10,13H2 |
| InChIKey | NTLHNECYLMWGCW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 12-oxododecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 12-oxododecanoate?
The IUPAC name of amino 12-oxododecanoate (CID 57157171) is amino 12-oxododecanoate.
What is the SMILES notation for amino 12-oxododecanoate?
The canonical SMILES for amino 12-oxododecanoate is NOC(=O)CCCCCCCCCCC=O.
What is the InChIKey of amino 12-oxododecanoate?
The InChIKey is NTLHNECYLMWGCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c13-16-12(15)10-8-6-4-2-1-3-5-7-9-11-14/h11H,1-10,13H2.
What are the key properties of amino 12-oxododecanoate?
amino 12-oxododecanoate has a molecular weight of 229.32 g/mol, XLogP of 2.50, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino 12-oxododecanoate is sourced from PubChem (CID 57157171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).