C9H16O3 — CID 79492734
1,1-dimethoxyhept-6-en-2-one (PubChem CID 79492734) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 1,1-dimethoxyhept-6-en-2-one.
| Compound Name | 1,1-dimethoxyhept-6-en-2-one |
|---|---|
| PubChem CID | 79492734 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 1,1-dimethoxyhept-6-en-2-one |
| SMILES | C=CCCCC(=O)C(OC)OC |
| InChI | InChI=1S/C9H16O3/c1-4-5-6-7-8(10)9(11-2)12-3/h4,9H,1,5-7H2,2-3H3 |
| InChIKey | IUCUDKIJKDBTGT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|