About 1,2-dimethoxyethane;2-methyl-2-nitropropane
1,2-dimethoxyethane;2-methyl-2-nitropropane (PubChem CID 174683857) has the molecular formula C8H19NO4
and a molecular weight of 193.24 g/mol. Its IUPAC name is 1,2-dimethoxyethane;2-methyl-2-nitropropane.
Molecular Properties
| Compound Name | 1,2-dimethoxyethane;2-methyl-2-nitropropane |
| PubChem CID | 174683857 |
| Molecular Formula | C8H19NO4 |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1,2-dimethoxyethane;2-methyl-2-nitropropane |
| SMILES | CC(C)(C)[N+](=O)[O-].COCCOC |
| InChI | InChI=1S/C4H9NO2.C4H10O2/c1-4(2,3)5(6)7;1-5-3-4-6-2/h1-3H3;3-4H2,1-2H3 |
| InChIKey | UFFPDJUETROCSI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethoxyethane;2-methyl-2-nitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethoxyethane;2-methyl-2-nitropropane?
The IUPAC name of 1,2-dimethoxyethane;2-methyl-2-nitropropane (CID 174683857) is 1,2-dimethoxyethane;2-methyl-2-nitropropane.
What is the SMILES notation for 1,2-dimethoxyethane;2-methyl-2-nitropropane?
The canonical SMILES for 1,2-dimethoxyethane;2-methyl-2-nitropropane is CC(C)(C)[N+](=O)[O-].COCCOC.
What is the InChIKey of 1,2-dimethoxyethane;2-methyl-2-nitropropane?
The InChIKey is UFFPDJUETROCSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.C4H10O2/c1-4(2,3)5(6)7;1-5-3-4-6-2/h1-3H3;3-4H2,1-2H3.
What are the key properties of 1,2-dimethoxyethane;2-methyl-2-nitropropane?
1,2-dimethoxyethane;2-methyl-2-nitropropane has a molecular weight of 193.24 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethoxyethane;2-methyl-2-nitropropane is sourced from PubChem (CID 174683857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).