About dibutoxy(oxo)azanium;2-methyl-2-nitropropane
dibutoxy(oxo)azanium;2-methyl-2-nitropropane (PubChem CID 87328716) has the molecular formula C12H27N2O5+
and a molecular weight of 279.36 g/mol. Its IUPAC name is dibutoxy(oxo)azanium;2-methyl-2-nitropropane.
Molecular Properties
| Compound Name | dibutoxy(oxo)azanium;2-methyl-2-nitropropane |
| PubChem CID | 87328716 |
| Molecular Formula | C12H27N2O5+ |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | dibutoxy(oxo)azanium;2-methyl-2-nitropropane |
| SMILES | CC(C)(C)[N+](=O)[O-].CCCCO[N+](=O)OCCCC |
| InChI | InChI=1S/C8H18NO3.C4H9NO2/c1-3-5-7-11-9(10)12-8-6-4-2;1-4(2,3)5(6)7/h3-8H2,1-2H3;1-3H3/q+1; |
| InChIKey | HRQMTCVSRMXFFE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dibutoxy(oxo)azanium;2-methyl-2-nitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutoxy(oxo)azanium;2-methyl-2-nitropropane?
The IUPAC name of dibutoxy(oxo)azanium;2-methyl-2-nitropropane (CID 87328716) is dibutoxy(oxo)azanium;2-methyl-2-nitropropane.
What is the SMILES notation for dibutoxy(oxo)azanium;2-methyl-2-nitropropane?
The canonical SMILES for dibutoxy(oxo)azanium;2-methyl-2-nitropropane is CC(C)(C)[N+](=O)[O-].CCCCO[N+](=O)OCCCC.
What is the InChIKey of dibutoxy(oxo)azanium;2-methyl-2-nitropropane?
The InChIKey is HRQMTCVSRMXFFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18NO3.C4H9NO2/c1-3-5-7-11-9(10)12-8-6-4-2;1-4(2,3)5(6)7/h3-8H2,1-2H3;1-3H3/q+1;.
What are the key properties of dibutoxy(oxo)azanium;2-methyl-2-nitropropane?
dibutoxy(oxo)azanium;2-methyl-2-nitropropane has a molecular weight of 279.36 g/mol, XLogP of 3.29, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutoxy(oxo)azanium;2-methyl-2-nitropropane is sourced from PubChem (CID 87328716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).